C29H37Cl2F3NO7P — CID 19792903
[3-(dibutylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]-1-hydroxypropan-2-yl] 2,3-dihydroxypropyl hydrogen phosphate (PubChem CID 19792903) has the molecular formula C29H37Cl2F3NO7P and a molecular weight of 670.49 g/mol. Its IUPAC name is [3-(dibutylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]-1-hydroxypropan-2-yl] 2,3-dihydroxypropyl hydrogen phosphate.
| Compound Name | [3-(dibutylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]-1-hydroxypropan-2-yl] 2,3-dihydroxypropyl hydrogen phosphate |
|---|---|
| PubChem CID | 19792903 |
| Molecular Formula | C29H37Cl2F3NO7P |
| Molecular Weight | 670.49 g/mol |
| Exact Mass | 669.16 |
| IUPAC Name | [3-(dibutylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]-1-hydroxypropan-2-yl] 2,3-dihydroxypropyl hydrogen phosphate |
| SMILES | CCCCN(CCCC)CC(OP(=O)(O)OCC(O)CO)C(O)c1cc2c(Cl)cc(Cl)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C29H37Cl2F3NO7P/c1-3-5-9-35(10-6-4-2)15-27(42-43(39,40)41-17-20(37)16-36)28(38)25-14-24-23(12-19(30)13-26(24)31)22-11-18(29(32,33)34)7-8-21(22)25/h7-8,11-14,20,27-28,36-38H,3-6,9-10,15-17H2,1-2H3,(H,39,40) |
| InChIKey | MAJDLOWABJIJNS-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.49 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|