C24H22Cl2F3NO6 — CID 91416785
2-[3-(butylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]propyl]peroxy-2-oxoethaneperoxoic acid (PubChem CID 91416785) has the molecular formula C24H22Cl2F3NO6 and a molecular weight of 548.34 g/mol. Its IUPAC name is 2-[3-(butylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]propyl]peroxy-2-oxoethaneperoxoic acid.
| Compound Name | 2-[3-(butylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]propyl]peroxy-2-oxoethaneperoxoic acid |
|---|---|
| PubChem CID | 91416785 |
| Molecular Formula | C24H22Cl2F3NO6 |
| Molecular Weight | 548.34 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | 2-[3-(butylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]propyl]peroxy-2-oxoethaneperoxoic acid |
| SMILES | CCCCNCCC(OOC(=O)C(=O)OO)c1cc2c(Cl)cc(Cl)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C24H22Cl2F3NO6/c1-2-3-7-30-8-6-21(35-36-23(32)22(31)34-33)19-12-18-17(10-14(25)11-20(18)26)16-9-13(24(27,28)29)4-5-15(16)19/h4-5,9-12,21,30,33H,2-3,6-8H2,1H3 |
| InChIKey | ICSGBBNQLSKNAR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.34 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|