C22H22Cl2F3NO — CID 58600503
3-(butylamino)-1-[6,8-dichloro-3-(trifluoromethyl)phenanthren-9-yl]propan-1-ol (PubChem CID 58600503) has the molecular formula C22H22Cl2F3NO and a molecular weight of 444.32 g/mol. Its IUPAC name is 3-(butylamino)-1-[6,8-dichloro-3-(trifluoromethyl)phenanthren-9-yl]propan-1-ol.
| Compound Name | 3-(butylamino)-1-[6,8-dichloro-3-(trifluoromethyl)phenanthren-9-yl]propan-1-ol |
|---|---|
| PubChem CID | 58600503 |
| Molecular Formula | C22H22Cl2F3NO |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 3-(butylamino)-1-[6,8-dichloro-3-(trifluoromethyl)phenanthren-9-yl]propan-1-ol |
| SMILES | CCCCNCCC(O)c1cc2ccc(C(F)(F)F)cc2c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C22H22Cl2F3NO/c1-2-3-7-28-8-6-20(29)18-9-13-4-5-14(22(25,26)27)10-16(13)17-11-15(23)12-19(24)21(17)18/h4-5,9-12,20,28-29H,2-3,6-8H2,1H3 |
| InChIKey | UHSUZROCSHETMS-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|