C28H30F6N2O — CID 90669322
1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(heptylamino)ethanol (PubChem CID 90669322) has the molecular formula C28H30F6N2O and a molecular weight of 524.55 g/mol. Its IUPAC name is 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(heptylamino)ethanol.
| Compound Name | 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(heptylamino)ethanol |
|---|---|
| PubChem CID | 90669322 |
| Molecular Formula | C28H30F6N2O |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 1-[2,6-bis[4-(trifluoromethyl)phenyl]-4-pyridinyl]-2-(heptylamino)ethanol |
| SMILES | CCCCCCCNCC(O)c1cc(-c2ccc(C(F)(F)F)cc2)nc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C28H30F6N2O/c1-2-3-4-5-6-15-35-18-26(37)21-16-24(19-7-11-22(12-8-19)27(29,30)31)36-25(17-21)20-9-13-23(14-10-20)28(32,33)34/h7-14,16-17,26,35,37H,2-6,15,18H2,1H3 |
| InChIKey | CZBPDPPBWLGNCK-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|