C22H26F6N2 — CID 155055027
N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]propyl]hexan-1-amine (PubChem CID 155055027) has the molecular formula C22H26F6N2 and a molecular weight of 432.45 g/mol. Its IUPAC name is N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]propyl]hexan-1-amine.
| Compound Name | N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]propyl]hexan-1-amine |
|---|---|
| PubChem CID | 155055027 |
| Molecular Formula | C22H26F6N2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]propyl]hexan-1-amine |
| SMILES | CCCCCCNCC(C)c1cc(-c2ccc(C(F)(F)F)cc2)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H26F6N2/c1-3-4-5-6-11-29-14-15(2)17-12-19(30-20(13-17)22(26,27)28)16-7-9-18(10-8-16)21(23,24)25/h7-10,12-13,15,29H,3-6,11,14H2,1-2H3 |
| InChIKey | NSHLXCSBCVAKOP-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|