C28H27F6FeN3O — CID 154622019
(1S)-2-[2-[(2-aminoethylamino)methyl]cyclopenta-2,4-dien-1-yl]-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]ethanol;cyclopenta-1,3-diene;iron(2+) (PubChem CID 154622019) has the molecular formula C28H27F6FeN3O and a molecular weight of 591.38 g/mol. Its IUPAC name is (1S)-2-[2-[(2-aminoethylamino)methyl]cyclopenta-2,4-dien-1-yl]-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]ethanol;cyclopenta-1,3-diene;iron(2+).
| Compound Name | (1S)-2-[2-[(2-aminoethylamino)methyl]cyclopenta-2,4-dien-1-yl]-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]ethanol;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 154622019 |
| Molecular Formula | C28H27F6FeN3O |
| Molecular Weight | 591.38 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | (1S)-2-[2-[(2-aminoethylamino)methyl]cyclopenta-2,4-dien-1-yl]-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]ethanol;cyclopenta-1,3-diene;iron(2+) |
| SMILES | NCCNCc1ccc[c-]1C[C@H](O)c1cc(-c2ccc(C(F)(F)F)cc2)nc(C(F)(F)F)c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C23H22F6N3O.C5H5.Fe/c24-22(25,26)18-6-4-14(5-7-18)19-10-17(12-21(32-19)23(27,28)29)20(33)11-15-2-1-3-16(15)13-31-9-8-30;1-2-4-5-3-1;/h1-7,10,12,20,31,33H,8-9,11,13,30H2;1-5H;/q2*-1;+2/t20-;;/m0../s1 |
| InChIKey | BZRPEMUVLZIFND-FJSYBICCSA-N |
| XLogP | 6.23 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.38 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|