C31H29F6N3 — CID 155055194
N'-benzhydryl-N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]propyl]ethane-1,2-diamine (PubChem CID 155055194) has the molecular formula C31H29F6N3 and a molecular weight of 557.58 g/mol. Its IUPAC name is N'-benzhydryl-N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]propyl]ethane-1,2-diamine.
| Compound Name | N'-benzhydryl-N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 155055194 |
| Molecular Formula | C31H29F6N3 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | N'-benzhydryl-N-[2-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]propyl]ethane-1,2-diamine |
| SMILES | CC(CNCCNC(c1ccccc1)c1ccccc1)c1cc(-c2ccc(C(F)(F)F)cc2)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H29F6N3/c1-21(20-38-16-17-39-29(23-8-4-2-5-9-23)24-10-6-3-7-11-24)25-18-27(40-28(19-25)31(35,36)37)22-12-14-26(15-13-22)30(32,33)34/h2-15,18-19,21,29,38-39H,16-17,20H2,1H3 |
| InChIKey | DBQLHRYUMVIPNJ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|