C32H29F3N4O2S2 — CID 162604369
N-[4-[2-[[(2R)-2-pyridin-3-ylpropyl]amino]ethyl]phenyl]-4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 162604369) has the molecular formula C32H29F3N4O2S2 and a molecular weight of 622.74 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-pyridin-3-ylpropyl]amino]ethyl]phenyl]-4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | N-[4-[2-[[(2R)-2-pyridin-3-ylpropyl]amino]ethyl]phenyl]-4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 162604369 |
| Molecular Formula | C32H29F3N4O2S2 |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | N-[4-[2-[[(2R)-2-pyridin-3-ylpropyl]amino]ethyl]phenyl]-4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | C[C@@H](CNCCc1ccc(NS(=O)(=O)c2ccc(-c3nc(-c4ccc(C(F)(F)F)cc4)cs3)cc2)cc1)c1cccnc1 |
| InChI | InChI=1S/C32H29F3N4O2S2/c1-22(26-3-2-17-36-20-26)19-37-18-16-23-4-12-28(13-5-23)39-43(40,41)29-14-8-25(9-15-29)31-38-30(21-42-31)24-6-10-27(11-7-24)32(33,34)35/h2-15,17,20-22,37,39H,16,18-19H2,1H3/t22-/m0/s1 |
| InChIKey | CGKJJXBBEXFJGA-QFIPXVFZSA-N |
| XLogP | 7.63 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|