C25H22F3N3O2S — CID 10116979
(1R)-1-pyridin-3-yl-2-[2-[4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenoxy]ethylamino]ethanol (PubChem CID 10116979) has the molecular formula C25H22F3N3O2S and a molecular weight of 485.53 g/mol. Its IUPAC name is (1R)-1-pyridin-3-yl-2-[2-[4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenoxy]ethylamino]ethanol.
| Compound Name | (1R)-1-pyridin-3-yl-2-[2-[4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenoxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 10116979 |
| Molecular Formula | C25H22F3N3O2S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (1R)-1-pyridin-3-yl-2-[2-[4-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenoxy]ethylamino]ethanol |
| SMILES | O[C@@H](CNCCOc1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3)cs2)cc1)c1cccnc1 |
| InChI | InChI=1S/C25H22F3N3O2S/c26-25(27,28)20-7-3-17(4-8-20)22-16-34-24(31-22)18-5-9-21(10-6-18)33-13-12-30-15-23(32)19-2-1-11-29-14-19/h1-11,14,16,23,30,32H,12-13,15H2/t23-/m0/s1 |
| InChIKey | MMILFFJNGQLORQ-QHCPKHFHSA-N |
| XLogP | 5.59 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|