C19H19F3N4O2 — CID 18532951
1-pyridin-3-yl-2-[2-[4-[2-(trifluoromethyl)-1H-imidazol-5-yl]phenoxy]ethylamino]ethanol (PubChem CID 18532951) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is 1-pyridin-3-yl-2-[2-[4-[2-(trifluoromethyl)-1H-imidazol-5-yl]phenoxy]ethylamino]ethanol.
| Compound Name | 1-pyridin-3-yl-2-[2-[4-[2-(trifluoromethyl)-1H-imidazol-5-yl]phenoxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 18532951 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-pyridin-3-yl-2-[2-[4-[2-(trifluoromethyl)-1H-imidazol-5-yl]phenoxy]ethylamino]ethanol |
| SMILES | OC(CNCCOc1ccc(-c2cnc(C(F)(F)F)[nH]2)cc1)c1cccnc1 |
| InChI | InChI=1S/C19H19F3N4O2/c20-19(21,22)18-25-11-16(26-18)13-3-5-15(6-4-13)28-9-8-24-12-17(27)14-2-1-7-23-10-14/h1-7,10-11,17,24,27H,8-9,12H2,(H,25,26) |
| InChIKey | FVZLAFYXHZWCOL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|