C18H21ClNO4- — CID 71297113
2-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]acetic acid chloride (PubChem CID 71297113) has the molecular formula C18H21ClNO4- and a molecular weight of 350.82 g/mol. Its IUPAC name is 2-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]acetic acid chloride.
| Compound Name | 2-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]acetic acid chloride |
|---|---|
| PubChem CID | 71297113 |
| Molecular Formula | C18H21ClNO4- |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]acetic acid chloride |
| SMILES | O=C(O)Cc1ccc(OCCNC[C@H](O)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C18H21NO4.ClH/c20-17(15-4-2-1-3-5-15)13-19-10-11-23-16-8-6-14(7-9-16)12-18(21)22;/h1-9,17,19-20H,10-13H2,(H,21,22);1H/p-1/t17-;/m0./s1 |
| InChIKey | KCEFVYIWOQSJCH-LMOVPXPDSA-M |
| XLogP | -0.98 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|