C18H22N2O5 — CID 10269121
2-[4-[2-[[2-(2-aminophenyl)-2-hydroxyethyl]amino]ethoxy]phenoxy]acetic acid (PubChem CID 10269121) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[4-[2-[[2-(2-aminophenyl)-2-hydroxyethyl]amino]ethoxy]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[[2-(2-aminophenyl)-2-hydroxyethyl]amino]ethoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10269121 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-[4-[2-[[2-(2-aminophenyl)-2-hydroxyethyl]amino]ethoxy]phenoxy]acetic acid |
| SMILES | Nc1ccccc1C(O)CNCCOc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C18H22N2O5/c19-16-4-2-1-3-15(16)17(21)11-20-9-10-24-13-5-7-14(8-6-13)25-12-18(22)23/h1-8,17,20-21H,9-12,19H2,(H,22,23) |
| InChIKey | YLNNDAFOGNQZBQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|