C25H31N3O3 — CID 59970246
2-[4-[2-[[(2R)-2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-hydroxyethyl]amino]ethoxy]phenyl]-N-methylacetamide (PubChem CID 59970246) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[4-[2-[[(2R)-2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-hydroxyethyl]amino]ethoxy]phenyl]-N-methylacetamide.
| Compound Name | 2-[4-[2-[[(2R)-2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-hydroxyethyl]amino]ethoxy]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 59970246 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-[4-[2-[[(2R)-2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-hydroxyethyl]amino]ethoxy]phenyl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1ccc(OCCNC[C@H](O)c2ccc(-n3c(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C25H31N3O3/c1-18-4-5-19(2)28(18)22-10-8-21(9-11-22)24(29)17-27-14-15-31-23-12-6-20(7-13-23)16-25(30)26-3/h4-13,24,27,29H,14-17H2,1-3H3,(H,26,30)/t24-/m0/s1 |
| InChIKey | IDBMACSJRRAQOP-DEOSSOPVSA-N |
| XLogP | 3.08 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|