C23H27N3O4 — CID 18434378
2-[4-[2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]ethoxy]phenyl]acetic acid (PubChem CID 18434378) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[4-[2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 18434378 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[4-[2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]ethoxy]phenyl]acetic acid |
| SMILES | Cc1ccc(C)n1-c1ccc(C(O)CNCCOc2ccc(CC(=O)O)cc2)cn1 |
| InChI | InChI=1S/C23H27N3O4/c1-16-3-4-17(2)26(16)22-10-7-19(14-25-22)21(27)15-24-11-12-30-20-8-5-18(6-9-20)13-23(28)29/h3-10,14,21,24,27H,11-13,15H2,1-2H3,(H,28,29) |
| InChIKey | SYWYHVKJNBHIOI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|