C20H23NO5 — CID 18997241
2-[4-[2-[(2-acetyloxy-2-phenylethyl)amino]ethoxy]phenyl]acetic acid (PubChem CID 18997241) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[4-[2-[(2-acetyloxy-2-phenylethyl)amino]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[(2-acetyloxy-2-phenylethyl)amino]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 18997241 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-[4-[2-[(2-acetyloxy-2-phenylethyl)amino]ethoxy]phenyl]acetic acid |
| SMILES | CC(=O)OC(CNCCOc1ccc(CC(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO5/c1-15(22)26-19(17-5-3-2-4-6-17)14-21-11-12-25-18-9-7-16(8-10-18)13-20(23)24/h2-10,19,21H,11-14H2,1H3,(H,23,24) |
| InChIKey | NIHJQUIVUPXERG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|