C23H21ClN4OS — CID 87975327
(1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]ethylamino]ethanol (PubChem CID 87975327) has the molecular formula C23H21ClN4OS and a molecular weight of 436.97 g/mol. Its IUPAC name is (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]ethylamino]ethanol.
| Compound Name | (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]ethylamino]ethanol |
|---|---|
| PubChem CID | 87975327 |
| Molecular Formula | C23H21ClN4OS |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]ethylamino]ethanol |
| SMILES | O[C@@H](CNCCc1ccc(-c2csc(-c3cccnc3)n2)cc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C23H21ClN4OS/c24-22-8-7-18(13-27-22)21(29)14-26-11-9-16-3-5-17(6-4-16)20-15-30-23(28-20)19-2-1-10-25-12-19/h1-8,10,12-13,15,21,26,29H,9,11,14H2/t21-/m0/s1 |
| InChIKey | SVEGUAOBJGHPLH-NRFANRHFSA-N |
| XLogP | 4.79 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|