C19H20F6N2O — CID 155055286
1-[2-(4-methylphenyl)-6-(trifluoromethyl)-4-pyridinyl]-2-(4,4,4-trifluorobutylamino)ethanol (PubChem CID 155055286) has the molecular formula C19H20F6N2O and a molecular weight of 406.37 g/mol. Its IUPAC name is 1-[2-(4-methylphenyl)-6-(trifluoromethyl)-4-pyridinyl]-2-(4,4,4-trifluorobutylamino)ethanol.
| Compound Name | 1-[2-(4-methylphenyl)-6-(trifluoromethyl)-4-pyridinyl]-2-(4,4,4-trifluorobutylamino)ethanol |
|---|---|
| PubChem CID | 155055286 |
| Molecular Formula | C19H20F6N2O |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-[2-(4-methylphenyl)-6-(trifluoromethyl)-4-pyridinyl]-2-(4,4,4-trifluorobutylamino)ethanol |
| SMILES | Cc1ccc(-c2cc(C(O)CNCCCC(F)(F)F)cc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H20F6N2O/c1-12-3-5-13(6-4-12)15-9-14(10-17(27-15)19(23,24)25)16(28)11-26-8-2-7-18(20,21)22/h3-6,9-10,16,26,28H,2,7-8,11H2,1H3 |
| InChIKey | WONAEVDXCPMCEC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|