C21H23ClN2O — CID 90669366
1-(2,6-diphenyl-4-pyridinyl)-2-(ethylamino)ethanol;hydrochloride (PubChem CID 90669366) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-(2,6-diphenyl-4-pyridinyl)-2-(ethylamino)ethanol;hydrochloride.
| Compound Name | 1-(2,6-diphenyl-4-pyridinyl)-2-(ethylamino)ethanol;hydrochloride |
|---|---|
| PubChem CID | 90669366 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-(2,6-diphenyl-4-pyridinyl)-2-(ethylamino)ethanol;hydrochloride |
| SMILES | CCNCC(O)c1cc(-c2ccccc2)nc(-c2ccccc2)c1.Cl |
| InChI | InChI=1S/C21H22N2O.ClH/c1-2-22-15-21(24)18-13-19(16-9-5-3-6-10-16)23-20(14-18)17-11-7-4-8-12-17;/h3-14,21-22,24H,2,15H2,1H3;1H |
| InChIKey | CAAANOUNXNNFGL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |