C19H20N2O3S — CID 133372946
1-(3,5-dimethoxyphenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethanol (PubChem CID 133372946) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethanol.
| Compound Name | 1-(3,5-dimethoxyphenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 133372946 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethanol |
| SMILES | COc1cc(OC)cc(C(O)CNc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C19H20N2O3S/c1-23-15-8-14(9-16(10-15)24-2)18(22)11-20-19-21-17(12-25-19)13-6-4-3-5-7-13/h3-10,12,18,22H,11H2,1-2H3,(H,20,21) |
| InChIKey | RGADVKRYTYLUOH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |