About 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine
4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine (PubChem CID 134943056) has the molecular formula C52H37N3
and a molecular weight of 703.89 g/mol. Its IUPAC name is 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine.
Molecular Properties
| Compound Name | 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine |
| PubChem CID | 134943056 |
| Molecular Formula | C52H37N3 |
| Molecular Weight | 703.89 g/mol |
| Exact Mass | 703.30 |
| IUPAC Name | 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine |
| SMILES | c1ccc(-c2cc(C(c3cc(-c4ccccc4)nc(-c4ccccc4)c3)c3cc(-c4ccccc4)nc(-c4ccccc4)c3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C52H37N3/c1-7-19-37(20-8-1)46-31-43(32-47(53-46)38-21-9-2-10-22-38)52(44-33-48(39-23-11-3-12-24-39)54-49(34-44)40-25-13-4-14-26-40)45-35-50(41-27-15-5-16-28-41)55-51(36-45)42-29-17-6-18-30-42/h1-36,52H |
| InChIKey | GVPBIMHTXDDGGR-UHFFFAOYSA-N |
| XLogP | 13.05 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 703.89 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine?
The IUPAC name of 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine (CID 134943056) is 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine.
What is the SMILES notation for 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine?
The canonical SMILES for 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine is c1ccc(-c2cc(C(c3cc(-c4ccccc4)nc(-c4ccccc4)c3)c3cc(-c4ccccc4)nc(-c4ccccc4)c3)cc(-c3ccccc3)n2)cc1.
What is the InChIKey of 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine?
The InChIKey is GVPBIMHTXDDGGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H37N3/c1-7-19-37(20-8-1)46-31-43(32-47(53-46)38-21-9-2-10-22-38)52(44-33-48(39-23-11-3-12-24-39)54-49(34-44)40-25-13-4-14-26-40)45-35-50(41-27-15-5-16-28-41)55-51(36-45)42-29-17-6-18-30-42/h1-36,52H.
What are the key properties of 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine?
4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine has a molecular weight of 703.89 g/mol, XLogP of 13.05, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(2,6-diphenyl-4-pyridinyl)methyl]-2,6-diphenylpyridine is sourced from PubChem (CID 134943056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).