C58H42N4 — CID 132595552
4-[2-(2,6-diphenyl-4-pyridinyl)-1,2-bis(4-pyridin-4-ylphenyl)ethyl]-2,6-diphenylpyridine (PubChem CID 132595552) has the molecular formula C58H42N4 and a molecular weight of 795.00 g/mol. Its IUPAC name is 4-[2-(2,6-diphenyl-4-pyridinyl)-1,2-bis(4-pyridin-4-ylphenyl)ethyl]-2,6-diphenylpyridine.
| Compound Name | 4-[2-(2,6-diphenyl-4-pyridinyl)-1,2-bis(4-pyridin-4-ylphenyl)ethyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 132595552 |
| Molecular Formula | C58H42N4 |
| Molecular Weight | 795.00 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | 4-[2-(2,6-diphenyl-4-pyridinyl)-1,2-bis(4-pyridin-4-ylphenyl)ethyl]-2,6-diphenylpyridine |
| SMILES | c1ccc(-c2cc(C(c3ccc(-c4ccncc4)cc3)C(c3ccc(-c4ccncc4)cc3)c3cc(-c4ccccc4)nc(-c4ccccc4)c3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C58H42N4/c1-5-13-45(14-6-1)53-37-51(38-54(61-53)46-15-7-2-8-16-46)57(49-25-21-41(22-26-49)43-29-33-59-34-30-43)58(50-27-23-42(24-28-50)44-31-35-60-36-32-44)52-39-55(47-17-9-3-10-18-47)62-56(40-52)48-19-11-4-12-20-48/h1-40,57-58H |
| InChIKey | NAISQUVOFBHLKQ-UHFFFAOYSA-N |
| XLogP | 14.23 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.00 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |