C18H18F6N2O — CID 161139957
(1R)-5-amino-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]pentan-1-ol (PubChem CID 161139957) has the molecular formula C18H18F6N2O and a molecular weight of 392.34 g/mol. Its IUPAC name is (1R)-5-amino-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]pentan-1-ol.
| Compound Name | (1R)-5-amino-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]pentan-1-ol |
|---|---|
| PubChem CID | 161139957 |
| Molecular Formula | C18H18F6N2O |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (1R)-5-amino-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]pentan-1-ol |
| SMILES | NCCCC[C@@H](O)c1ccc(-c2ccc(C(F)(F)F)cc2)nc1C(F)(F)F |
| InChI | InChI=1S/C18H18F6N2O/c19-17(20,21)12-6-4-11(5-7-12)14-9-8-13(15(27)3-1-2-10-25)16(26-14)18(22,23)24/h4-9,15,27H,1-3,10,25H2/t15-/m1/s1 |
| InChIKey | JENATYGIXKUNKG-OAHLLOKOSA-N |
| XLogP | 4.95 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|