C36H39F6N3OS — CID 159091652
(1R)-6-(4-benzhydrylpiperazin-1-yl)-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]hexan-1-ol;sulfane (PubChem CID 159091652) has the molecular formula C36H39F6N3OS and a molecular weight of 675.78 g/mol. Its IUPAC name is (1R)-6-(4-benzhydrylpiperazin-1-yl)-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]hexan-1-ol;sulfane.
| Compound Name | (1R)-6-(4-benzhydrylpiperazin-1-yl)-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]hexan-1-ol;sulfane |
|---|---|
| PubChem CID | 159091652 |
| Molecular Formula | C36H39F6N3OS |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.27 |
| IUPAC Name | (1R)-6-(4-benzhydrylpiperazin-1-yl)-1-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]hexan-1-ol;sulfane |
| SMILES | O[C@H](CCCCCN1CCN(C(c2ccccc2)c2ccccc2)CC1)c1ccc(-c2ccc(C(F)(F)F)cc2)nc1C(F)(F)F.S |
| InChI | InChI=1S/C36H37F6N3O.H2S/c37-35(38,39)29-17-15-26(16-18-29)31-20-19-30(34(43-31)36(40,41)42)32(46)14-8-3-9-21-44-22-24-45(25-23-44)33(27-10-4-1-5-11-27)28-12-6-2-7-13-28;/h1-2,4-7,10-13,15-20,32-33,46H,3,8-9,14,21-25H2;1H2/t32-;/m1./s1 |
| InChIKey | KCDIABHMIJBUEW-RYWNGCACSA-N |
| XLogP | 8.90 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|