C31H40N2O — CID 76965746
(1R)-4-(4-benzhydrylpiperazin-1-yl)-1-(4-tert-butylphenyl)butan-1-ol (PubChem CID 76965746) has the molecular formula C31H40N2O and a molecular weight of 456.67 g/mol. Its IUPAC name is (1R)-4-(4-benzhydrylpiperazin-1-yl)-1-(4-tert-butylphenyl)butan-1-ol.
| Compound Name | (1R)-4-(4-benzhydrylpiperazin-1-yl)-1-(4-tert-butylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 76965746 |
| Molecular Formula | C31H40N2O |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | (1R)-4-(4-benzhydrylpiperazin-1-yl)-1-(4-tert-butylphenyl)butan-1-ol |
| SMILES | CC(C)(C)c1ccc([C@H](O)CCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H40N2O/c1-31(2,3)28-18-16-25(17-19-28)29(34)15-10-20-32-21-23-33(24-22-32)30(26-11-6-4-7-12-26)27-13-8-5-9-14-27/h4-9,11-14,16-19,29-30,34H,10,15,20-24H2,1-3H3/t29-/m1/s1 |
| InChIKey | DCWPQKGBKYLNRG-GDLZYMKVSA-N |
| XLogP | 6.20 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |