C18H26F3NO — CID 142203549
5-(4-methylpiperidin-1-yl)-1-[4-(trifluoromethyl)phenyl]pentan-1-ol (PubChem CID 142203549) has the molecular formula C18H26F3NO and a molecular weight of 329.41 g/mol. Its IUPAC name is 5-(4-methylpiperidin-1-yl)-1-[4-(trifluoromethyl)phenyl]pentan-1-ol.
| Compound Name | 5-(4-methylpiperidin-1-yl)-1-[4-(trifluoromethyl)phenyl]pentan-1-ol |
|---|---|
| PubChem CID | 142203549 |
| Molecular Formula | C18H26F3NO |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 5-(4-methylpiperidin-1-yl)-1-[4-(trifluoromethyl)phenyl]pentan-1-ol |
| SMILES | CC1CCN(CCCCC(O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H26F3NO/c1-14-9-12-22(13-10-14)11-3-2-4-17(23)15-5-7-16(8-6-15)18(19,20)21/h5-8,14,17,23H,2-4,9-13H2,1H3 |
| InChIKey | PVLGCAGEQYEACE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|