C14H18F3N — CID 86887618
3-methyl-1-[1-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine (PubChem CID 86887618) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is 3-methyl-1-[1-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine.
| Compound Name | 3-methyl-1-[1-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 86887618 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-methyl-1-[1-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidine |
| SMILES | CC1CCN(C(C)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H18F3N/c1-10-7-8-18(9-10)11(2)12-3-5-13(6-4-12)14(15,16)17/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | BWQPJNCARQCPHL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |