C17H29ClN2 — CID 119905772
1-[1-(4-tert-butylphenyl)ethyl]-N-methylpyrrolidin-3-amine;hydrochloride (PubChem CID 119905772) has the molecular formula C17H29ClN2 and a molecular weight of 296.89 g/mol. Its IUPAC name is 1-[1-(4-tert-butylphenyl)ethyl]-N-methylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[1-(4-tert-butylphenyl)ethyl]-N-methylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119905772 |
| Molecular Formula | C17H29ClN2 |
| Molecular Weight | 296.89 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 1-[1-(4-tert-butylphenyl)ethyl]-N-methylpyrrolidin-3-amine;hydrochloride |
| SMILES | CNC1CCN(C(C)c2ccc(C(C)(C)C)cc2)C1.Cl |
| InChI | InChI=1S/C17H28N2.ClH/c1-13(19-11-10-16(12-19)18-5)14-6-8-15(9-7-14)17(2,3)4;/h6-9,13,16,18H,10-12H2,1-5H3;1H |
| InChIKey | XHFKBICLPMODFO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |