C18H31ClN2 — CID 119915816
[1-[1-(4-tert-butylphenyl)ethyl]piperidin-3-yl]methanamine;hydrochloride (PubChem CID 119915816) has the molecular formula C18H31ClN2 and a molecular weight of 310.91 g/mol. Its IUPAC name is [1-[1-(4-tert-butylphenyl)ethyl]piperidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[1-(4-tert-butylphenyl)ethyl]piperidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119915816 |
| Molecular Formula | C18H31ClN2 |
| Molecular Weight | 310.91 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | [1-[1-(4-tert-butylphenyl)ethyl]piperidin-3-yl]methanamine;hydrochloride |
| SMILES | CC(c1ccc(C(C)(C)C)cc1)N1CCCC(CN)C1.Cl |
| InChI | InChI=1S/C18H30N2.ClH/c1-14(20-11-5-6-15(12-19)13-20)16-7-9-17(10-8-16)18(2,3)4;/h7-10,14-15H,5-6,11-13,19H2,1-4H3;1H |
| InChIKey | RNJUZTBNGJJZOD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.91 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |