C13H20N2 — CID 2237132
[(3R)-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]methanamine (PubChem CID 2237132) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is [(3R)-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]methanamine.
| Compound Name | [(3R)-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 2237132 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | [(3R)-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]methanamine |
| SMILES | C[C@@H](c1ccccc1)N1CC[C@H](CN)C1 |
| InChI | InChI=1S/C13H20N2/c1-11(13-5-3-2-4-6-13)15-8-7-12(9-14)10-15/h2-6,11-12H,7-10,14H2,1H3/t11-,12+/m0/s1 |
| InChIKey | KNCVIVHOXNPVNM-NWDGAFQWSA-N |
| XLogP | 2.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |