C14H23ClN2 — CID 119905925
N-methyl-1-[1-(3-methylphenyl)ethyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 119905925) has the molecular formula C14H23ClN2 and a molecular weight of 254.81 g/mol. Its IUPAC name is N-methyl-1-[1-(3-methylphenyl)ethyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | N-methyl-1-[1-(3-methylphenyl)ethyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119905925 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.81 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-methyl-1-[1-(3-methylphenyl)ethyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | CNC1CCN(C(C)c2cccc(C)c2)C1.Cl |
| InChI | InChI=1S/C14H22N2.ClH/c1-11-5-4-6-13(9-11)12(2)16-8-7-14(10-16)15-3;/h4-6,9,12,14-15H,7-8,10H2,1-3H3;1H |
| InChIKey | OCQGWVQLUWMPRU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.81 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |