C15H23ClF2N2O — CID 119919002
1-[1-[4-(difluoromethoxy)phenyl]ethyl]-N-methylpiperidin-3-amine;hydrochloride (PubChem CID 119919002) has the molecular formula C15H23ClF2N2O and a molecular weight of 320.81 g/mol. Its IUPAC name is 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-N-methylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-N-methylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119919002 |
| Molecular Formula | C15H23ClF2N2O |
| Molecular Weight | 320.81 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-N-methylpiperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(C(C)c2ccc(OC(F)F)cc2)C1.Cl |
| InChI | InChI=1S/C15H22F2N2O.ClH/c1-11(19-9-3-4-13(10-19)18-2)12-5-7-14(8-6-12)20-15(16)17;/h5-8,11,13,15,18H,3-4,9-10H2,1-2H3;1H |
| InChIKey | FMPFKECLQNBWAF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |