C14H19F2NO2 — CID 47704692
1-[1-[4-(difluoromethoxy)phenyl]ethyl]piperidin-3-ol (PubChem CID 47704692) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-[1-[4-(difluoromethoxy)phenyl]ethyl]piperidin-3-ol.
| Compound Name | 1-[1-[4-(difluoromethoxy)phenyl]ethyl]piperidin-3-ol |
|---|---|
| PubChem CID | 47704692 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-[1-[4-(difluoromethoxy)phenyl]ethyl]piperidin-3-ol |
| SMILES | CC(c1ccc(OC(F)F)cc1)N1CCCC(O)C1 |
| InChI | InChI=1S/C14H19F2NO2/c1-10(17-8-2-3-12(18)9-17)11-4-6-13(7-5-11)19-14(15)16/h4-7,10,12,14,18H,2-3,8-9H2,1H3 |
| InChIKey | RNECHYPYNOVXQD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |