C18H18F3N — CID 162572290
3-methyl-1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]azetidine (PubChem CID 162572290) has the molecular formula C18H18F3N and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-methyl-1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]azetidine.
| Compound Name | 3-methyl-1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]azetidine |
|---|---|
| PubChem CID | 162572290 |
| Molecular Formula | C18H18F3N |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-methyl-1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]azetidine |
| SMILES | CC1CN(C(c2ccccc2)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H18F3N/c1-13-11-22(12-13)17(14-5-3-2-4-6-14)15-7-9-16(10-8-15)18(19,20)21/h2-10,13,17H,11-12H2,1H3 |
| InChIKey | PKHRZWCDCQBYRA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |