C22H27F3N2 — CID 58665831
(3S)-3-tert-butyl-1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 58665831) has the molecular formula C22H27F3N2 and a molecular weight of 376.47 g/mol. Its IUPAC name is (3S)-3-tert-butyl-1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | (3S)-3-tert-butyl-1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 58665831 |
| Molecular Formula | C22H27F3N2 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (3S)-3-tert-butyl-1-[phenyl-[4-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | CC(C)(C)[C@H]1CN(C(c2ccccc2)c2ccc(C(F)(F)F)cc2)CCN1 |
| InChI | InChI=1S/C22H27F3N2/c1-21(2,3)19-15-27(14-13-26-19)20(16-7-5-4-6-8-16)17-9-11-18(12-10-17)22(23,24)25/h4-12,19-20,26H,13-15H2,1-3H3/t19-,20?/m1/s1 |
| InChIKey | QADGLAZDGRWWGI-FIWHBWSRSA-N |
| XLogP | 5.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |