C20H22F4N2 — CID 170615246
1-[bis[4-(difluoromethyl)phenyl]methyl]-3-methylpiperazine (PubChem CID 170615246) has the molecular formula C20H22F4N2 and a molecular weight of 366.40 g/mol. Its IUPAC name is 1-[bis[4-(difluoromethyl)phenyl]methyl]-3-methylpiperazine.
| Compound Name | 1-[bis[4-(difluoromethyl)phenyl]methyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 170615246 |
| Molecular Formula | C20H22F4N2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[bis[4-(difluoromethyl)phenyl]methyl]-3-methylpiperazine |
| SMILES | CC1CN(C(c2ccc(C(F)F)cc2)c2ccc(C(F)F)cc2)CCN1 |
| InChI | InChI=1S/C20H22F4N2/c1-13-12-26(11-10-25-13)18(14-2-6-16(7-3-14)19(21)22)15-4-8-17(9-5-15)20(23)24/h2-9,13,18-20,25H,10-12H2,1H3 |
| InChIKey | DOSBMRDIDPPHLP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |