C13H18F2N2 — CID 120615750
(3R)-1-[[4-(difluoromethyl)phenyl]methyl]-3-methylpiperazine (PubChem CID 120615750) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (3R)-1-[[4-(difluoromethyl)phenyl]methyl]-3-methylpiperazine.
| Compound Name | (3R)-1-[[4-(difluoromethyl)phenyl]methyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 120615750 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3R)-1-[[4-(difluoromethyl)phenyl]methyl]-3-methylpiperazine |
| SMILES | C[C@@H]1CN(Cc2ccc(C(F)F)cc2)CCN1 |
| InChI | InChI=1S/C13H18F2N2/c1-10-8-17(7-6-16-10)9-11-2-4-12(5-3-11)13(14)15/h2-5,10,13,16H,6-9H2,1H3/t10-/m1/s1 |
| InChIKey | SVMNARQAVROCEV-SNVBAGLBSA-N |
| XLogP | 2.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |