C18H21BrN2 — CID 68931032
(3R)-1-[(3-bromophenyl)-phenylmethyl]-3-methylpiperazine (PubChem CID 68931032) has the molecular formula C18H21BrN2 and a molecular weight of 345.28 g/mol. Its IUPAC name is (3R)-1-[(3-bromophenyl)-phenylmethyl]-3-methylpiperazine.
| Compound Name | (3R)-1-[(3-bromophenyl)-phenylmethyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 68931032 |
| Molecular Formula | C18H21BrN2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (3R)-1-[(3-bromophenyl)-phenylmethyl]-3-methylpiperazine |
| SMILES | C[C@@H]1CN(C(c2ccccc2)c2cccc(Br)c2)CCN1 |
| InChI | InChI=1S/C18H21BrN2/c1-14-13-21(11-10-20-14)18(15-6-3-2-4-7-15)16-8-5-9-17(19)12-16/h2-9,12,14,18,20H,10-11,13H2,1H3/t14-,18?/m1/s1 |
| InChIKey | ZEPWGBWPZSAGDR-IKJXHCRLSA-N |
| XLogP | 3.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |