C19H24Cl2N2O — CID 170615369
1-[bis(4-chlorophenyl)methyl]-3-methylpiperazine;methanol (PubChem CID 170615369) has the molecular formula C19H24Cl2N2O and a molecular weight of 367.32 g/mol. Its IUPAC name is 1-[bis(4-chlorophenyl)methyl]-3-methylpiperazine;methanol.
| Compound Name | 1-[bis(4-chlorophenyl)methyl]-3-methylpiperazine;methanol |
|---|---|
| PubChem CID | 170615369 |
| Molecular Formula | C19H24Cl2N2O |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-[bis(4-chlorophenyl)methyl]-3-methylpiperazine;methanol |
| SMILES | CC1CN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CCN1.CO |
| InChI | InChI=1S/C18H20Cl2N2.CH4O/c1-13-12-22(11-10-21-13)18(14-2-6-16(19)7-3-14)15-4-8-17(20)9-5-15;1-2/h2-9,13,18,21H,10-12H2,1H3;2H,1H3 |
| InChIKey | GKEKQWYPNPWNRJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |