C18H31ClN2 — CID 176717104
1-[1-(4-chlorophenyl)-3-methylbutyl]-3-methylpiperazine;ethane (PubChem CID 176717104) has the molecular formula C18H31ClN2 and a molecular weight of 310.91 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-3-methylbutyl]-3-methylpiperazine;ethane.
| Compound Name | 1-[1-(4-chlorophenyl)-3-methylbutyl]-3-methylpiperazine;ethane |
|---|---|
| PubChem CID | 176717104 |
| Molecular Formula | C18H31ClN2 |
| Molecular Weight | 310.91 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-3-methylbutyl]-3-methylpiperazine;ethane |
| SMILES | CC.CC(C)CC(c1ccc(Cl)cc1)N1CCNC(C)C1 |
| InChI | InChI=1S/C16H25ClN2.C2H6/c1-12(2)10-16(14-4-6-15(17)7-5-14)19-9-8-18-13(3)11-19;1-2/h4-7,12-13,16,18H,8-11H2,1-3H3;1-2H3 |
| InChIKey | OAVKCDZXPFTXHA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |