C19H23NO4 — CID 10568359
(3S,4S,5S,6S)-1-benzhydrylazepane-3,4,5,6-tetrol (PubChem CID 10568359) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3S,4S,5S,6S)-1-benzhydrylazepane-3,4,5,6-tetrol.
| Compound Name | (3S,4S,5S,6S)-1-benzhydrylazepane-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 10568359 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (3S,4S,5S,6S)-1-benzhydrylazepane-3,4,5,6-tetrol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](O)CN(C(c2ccccc2)c2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C19H23NO4/c21-15-11-20(12-16(22)19(24)18(15)23)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-19,21-24H,11-12H2/t15-,16-,18-,19-/m0/s1 |
| InChIKey | NNDIVXWVDKLGTI-CAMMJAKZSA-N |
| XLogP | 0.54 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |