C20H22N2O2 — CID 69107586
(1-benzhydrylazetidin-3-yl)-cyclopropylcarbamic acid (PubChem CID 69107586) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (1-benzhydrylazetidin-3-yl)-cyclopropylcarbamic acid.
| Compound Name | (1-benzhydrylazetidin-3-yl)-cyclopropylcarbamic acid |
|---|---|
| PubChem CID | 69107586 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (1-benzhydrylazetidin-3-yl)-cyclopropylcarbamic acid |
| SMILES | O=C(O)N(C1CC1)C1CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H22N2O2/c23-20(24)22(17-11-12-17)18-13-21(14-18)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-19H,11-14H2,(H,23,24) |
| InChIKey | NTLQCCKTXGNKHZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |