C22H26N2O — CID 131875139
(1-benzhydrylazetidin-3-yl)-piperidin-1-ylmethanone (PubChem CID 131875139) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (1-benzhydrylazetidin-3-yl)-piperidin-1-ylmethanone.
| Compound Name | (1-benzhydrylazetidin-3-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 131875139 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (1-benzhydrylazetidin-3-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(C1CN(C(c2ccccc2)c2ccccc2)C1)N1CCCCC1 |
| InChI | InChI=1S/C22H26N2O/c25-22(23-14-8-3-9-15-23)20-16-24(17-20)21(18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-2,4-7,10-13,20-21H,3,8-9,14-17H2 |
| InChIKey | DTDHZKDQHXGEPV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |