C25H30N2O3 — CID 29133609
ethyl 1-(1-benzhydrylazetidine-3-carbonyl)piperidine-4-carboxylate (PubChem CID 29133609) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is ethyl 1-(1-benzhydrylazetidine-3-carbonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(1-benzhydrylazetidine-3-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 29133609 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | ethyl 1-(1-benzhydrylazetidine-3-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2CN(C(c3ccccc3)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C25H30N2O3/c1-2-30-25(29)21-13-15-26(16-14-21)24(28)22-17-27(18-22)23(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,21-23H,2,13-18H2,1H3 |
| InChIKey | CZNAAOIKRGUJBB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |