C28H35N3O2 — CID 24891624
(4-benzhydrylpiperazin-1-yl)-[2-(3-methylpiperidine-1-carbonyl)cyclopropyl]methanone (PubChem CID 24891624) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[2-(3-methylpiperidine-1-carbonyl)cyclopropyl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[2-(3-methylpiperidine-1-carbonyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 24891624 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[2-(3-methylpiperidine-1-carbonyl)cyclopropyl]methanone |
| SMILES | CC1CCCN(C(=O)C2CC2C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C28H35N3O2/c1-21-9-8-14-31(20-21)28(33)25-19-24(25)27(32)30-17-15-29(16-18-30)26(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-7,10-13,21,24-26H,8-9,14-20H2,1H3 |
| InChIKey | NJAZJSFNQBHJJS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |