C28H31N3O3 — CID 35552494
(4-benzhydrylpiperazin-1-yl)-[(3S)-1-(furan-3-carbonyl)piperidin-3-yl]methanone (PubChem CID 35552494) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[(3S)-1-(furan-3-carbonyl)piperidin-3-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[(3S)-1-(furan-3-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 35552494 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[(3S)-1-(furan-3-carbonyl)piperidin-3-yl]methanone |
| SMILES | O=C(c1ccoc1)N1CCC[C@H](C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C28H31N3O3/c32-27(24-12-7-14-31(20-24)28(33)25-13-19-34-21-25)30-17-15-29(16-18-30)26(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-6,8-11,13,19,21,24,26H,7,12,14-18,20H2/t24-/m0/s1 |
| InChIKey | AEFGSYIADDMKSV-DEOSSOPVSA-N |
| XLogP | 4.07 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |