C20H23NO — CID 1292213
1-[(3S)-3-methylpiperidin-1-yl]-2,2-diphenylethanone (PubChem CID 1292213) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-[(3S)-3-methylpiperidin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[(3S)-3-methylpiperidin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 1292213 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1-[(3S)-3-methylpiperidin-1-yl]-2,2-diphenylethanone |
| SMILES | C[C@H]1CCCN(C(=O)C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H23NO/c1-16-9-8-14-21(15-16)20(22)19(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-7,10-13,16,19H,8-9,14-15H2,1H3/t16-/m0/s1 |
| InChIKey | WKMMNBATLPFXJN-INIZCTEOSA-N |
| XLogP | 4.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |