C23H24N2O2S — CID 21183789
N-(1-benzhydrylazetidin-3-yl)-N-phenylmethanesulfonamide (PubChem CID 21183789) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-(1-benzhydrylazetidin-3-yl)-N-phenylmethanesulfonamide.
| Compound Name | N-(1-benzhydrylazetidin-3-yl)-N-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 21183789 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-(1-benzhydrylazetidin-3-yl)-N-phenylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(c1ccccc1)C1CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H24N2O2S/c1-28(26,27)25(21-15-9-4-10-16-21)22-17-24(18-22)23(19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-16,22-23H,17-18H2,1H3 |
| InChIKey | BEDVJXBHQCWLEI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |