C24H22F2N2O4S — CID 162713233
[4-[(S)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]phenyl] formate (PubChem CID 162713233) has the molecular formula C24H22F2N2O4S and a molecular weight of 472.51 g/mol. Its IUPAC name is [4-[(S)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]phenyl] formate.
| Compound Name | [4-[(S)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]phenyl] formate |
|---|---|
| PubChem CID | 162713233 |
| Molecular Formula | C24H22F2N2O4S |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [4-[(S)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]phenyl] formate |
| SMILES | CS(=O)(=O)N(c1cc(F)cc(F)c1)C1CN([C@@H](c2ccccc2)c2ccc(OC=O)cc2)C1 |
| InChI | InChI=1S/C24H22F2N2O4S/c1-33(30,31)28(21-12-19(25)11-20(26)13-21)22-14-27(15-22)24(17-5-3-2-4-6-17)18-7-9-23(10-8-18)32-16-29/h2-13,16,22,24H,14-15H2,1H3/t24-/m0/s1 |
| InChIKey | CDPYSUHRZARWAR-DEOSSOPVSA-N |
| XLogP | 3.74 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|