About 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid
4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid (PubChem CID 162713240) has the molecular formula C24H22F2N2O4S
and a molecular weight of 472.51 g/mol. Its IUPAC name is 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid |
| PubChem CID | 162713240 |
| Molecular Formula | C24H22F2N2O4S |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid |
| SMILES | CS(=O)(=O)N(c1cc(F)cc(F)c1)C1CN([C@H](c2ccccc2)c2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C24H22F2N2O4S/c1-33(31,32)28(21-12-19(25)11-20(26)13-21)22-14-27(15-22)23(16-5-3-2-4-6-16)17-7-9-18(10-8-17)24(29)30/h2-13,22-23H,14-15H2,1H3,(H,29,30)/t23-/m1/s1 |
| InChIKey | BQALFUDMBMKOHE-HSZRJFAPSA-N |
| XLogP | 3.90 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid?
The IUPAC name of 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid (CID 162713240) is 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid.
What is the SMILES notation for 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid?
The canonical SMILES for 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid is CS(=O)(=O)N(c1cc(F)cc(F)c1)C1CN([C@H](c2ccccc2)c2ccc(C(=O)O)cc2)C1.
What is the InChIKey of 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid?
The InChIKey is BQALFUDMBMKOHE-HSZRJFAPSA-N. The full InChI is InChI=1S/C24H22F2N2O4S/c1-33(31,32)28(21-12-19(25)11-20(26)13-21)22-14-27(15-22)23(16-5-3-2-4-6-16)17-7-9-18(10-8-17)24(29)30/h2-13,22-23H,14-15H2,1H3,(H,29,30)/t23-/m1/s1.
What are the key properties of 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid?
4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid has a molecular weight of 472.51 g/mol, XLogP of 3.90, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(R)-[3-(3,5-difluoro-N-methylsulfonylanilino)azetidin-1-yl]-phenylmethyl]benzoic acid is sourced from PubChem (CID 162713240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).