C21H26F6N2O — CID 88920621
1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-(octylamino)ethanol (PubChem CID 88920621) has the molecular formula C21H26F6N2O and a molecular weight of 436.44 g/mol. Its IUPAC name is 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-(octylamino)ethanol.
| Compound Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-(octylamino)ethanol |
|---|---|
| PubChem CID | 88920621 |
| Molecular Formula | C21H26F6N2O |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-(octylamino)ethanol |
| SMILES | CCCCCCCCNCC(O)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C21H26F6N2O/c1-2-3-4-5-6-7-11-28-13-17(30)15-12-18(21(25,26)27)29-19-14(15)9-8-10-16(19)20(22,23)24/h8-10,12,17,28,30H,2-7,11,13H2,1H3 |
| InChIKey | WXXZEDMYXFPFHE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|